About ethane-1,2-diol;pentan-3-one
ethane-1,2-diol;pentan-3-one (PubChem CID 87374843) has the molecular formula C7H16O3
and a molecular weight of 148.20 g/mol. Its IUPAC name is ethane-1,2-diol;pentan-3-one.
Molecular Properties
| Compound Name | ethane-1,2-diol;pentan-3-one |
| PubChem CID | 87374843 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | ethane-1,2-diol;pentan-3-one |
| SMILES | CCC(=O)CC.OCCO |
| InChI | InChI=1S/C5H10O.C2H6O2/c1-3-5(6)4-2;3-1-2-4/h3-4H2,1-2H3;3-4H,1-2H2 |
| InChIKey | VNZPHMVQAYQUTF-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane-1,2-diol;pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;pentan-3-one?
The IUPAC name of ethane-1,2-diol;pentan-3-one (CID 87374843) is ethane-1,2-diol;pentan-3-one.
What is the SMILES notation for ethane-1,2-diol;pentan-3-one?
The canonical SMILES for ethane-1,2-diol;pentan-3-one is CCC(=O)CC.OCCO.
What is the InChIKey of ethane-1,2-diol;pentan-3-one?
The InChIKey is VNZPHMVQAYQUTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C2H6O2/c1-3-5(6)4-2;3-1-2-4/h3-4H2,1-2H3;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;pentan-3-one?
ethane-1,2-diol;pentan-3-one has a molecular weight of 148.20 g/mol, XLogP of 0.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;pentan-3-one is sourced from PubChem (CID 87374843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).