About pentan-3-one;trihydrochloride
pentan-3-one;trihydrochloride (PubChem CID 172711203) has the molecular formula C5H13Cl3O
and a molecular weight of 195.52 g/mol. Its IUPAC name is pentan-3-one;trihydrochloride.
Molecular Properties
| Compound Name | pentan-3-one;trihydrochloride |
| PubChem CID | 172711203 |
| Molecular Formula | C5H13Cl3O |
| Molecular Weight | 195.52 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | pentan-3-one;trihydrochloride |
| SMILES | CCC(=O)CC.Cl.Cl.Cl |
| InChI | InChI=1S/C5H10O.3ClH/c1-3-5(6)4-2;;;/h3-4H2,1-2H3;3*1H |
| InChIKey | FGSJANLNKZZUBV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze pentan-3-one;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-one;trihydrochloride?
The IUPAC name of pentan-3-one;trihydrochloride (CID 172711203) is pentan-3-one;trihydrochloride.
What is the SMILES notation for pentan-3-one;trihydrochloride?
The canonical SMILES for pentan-3-one;trihydrochloride is CCC(=O)CC.Cl.Cl.Cl.
What is the InChIKey of pentan-3-one;trihydrochloride?
The InChIKey is FGSJANLNKZZUBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.3ClH/c1-3-5(6)4-2;;;/h3-4H2,1-2H3;3*1H.
What are the key properties of pentan-3-one;trihydrochloride?
pentan-3-one;trihydrochloride has a molecular weight of 195.52 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-one;trihydrochloride is sourced from PubChem (CID 172711203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).