About pentan-3-one;thiolane
pentan-3-one;thiolane (PubChem CID 143952435) has the molecular formula C9H18OS
and a molecular weight of 174.31 g/mol. Its IUPAC name is pentan-3-one;thiolane.
Molecular Properties
| Compound Name | pentan-3-one;thiolane |
| PubChem CID | 143952435 |
| Molecular Formula | C9H18OS |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | pentan-3-one;thiolane |
| SMILES | C1CCSC1.CCC(=O)CC |
| InChI | InChI=1S/C5H10O.C4H8S/c1-3-5(6)4-2;1-2-4-5-3-1/h3-4H2,1-2H3;1-4H2 |
| InChIKey | RWQGTKHFUQNNHL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentan-3-one;thiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-one;thiolane?
The IUPAC name of pentan-3-one;thiolane (CID 143952435) is pentan-3-one;thiolane.
What is the SMILES notation for pentan-3-one;thiolane?
The canonical SMILES for pentan-3-one;thiolane is C1CCSC1.CCC(=O)CC.
What is the InChIKey of pentan-3-one;thiolane?
The InChIKey is RWQGTKHFUQNNHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C4H8S/c1-3-5(6)4-2;1-2-4-5-3-1/h3-4H2,1-2H3;1-4H2.
What are the key properties of pentan-3-one;thiolane?
pentan-3-one;thiolane has a molecular weight of 174.31 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-one;thiolane is sourced from PubChem (CID 143952435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).