About thiane;acetate
thiane;acetate (PubChem CID 18790032) has the molecular formula C12H23O2S2-
and a molecular weight of 263.45 g/mol. Its IUPAC name is thiane;acetate.
Molecular Properties
| Compound Name | thiane;acetate |
| PubChem CID | 18790032 |
| Molecular Formula | C12H23O2S2- |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | thiane;acetate |
| SMILES | C1CCSCC1.C1CCSCC1.CC(=O)[O-] |
| InChI | InChI=1S/2C5H10S.C2H4O2/c2*1-2-4-6-5-3-1;1-2(3)4/h2*1-5H2;1H3,(H,3,4)/p-1 |
| InChIKey | BZBGKZZPXCULRB-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thiane;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiane;acetate?
The IUPAC name of thiane;acetate (CID 18790032) is thiane;acetate.
What is the SMILES notation for thiane;acetate?
The canonical SMILES for thiane;acetate is C1CCSCC1.C1CCSCC1.CC(=O)[O-].
What is the InChIKey of thiane;acetate?
The InChIKey is BZBGKZZPXCULRB-UHFFFAOYSA-M. The full InChI is InChI=1S/2C5H10S.C2H4O2/c2*1-2-4-6-5-3-1;1-2(3)4/h2*1-5H2;1H3,(H,3,4)/p-1.
What are the key properties of thiane;acetate?
thiane;acetate has a molecular weight of 263.45 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiane;acetate is sourced from PubChem (CID 18790032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).