3,5,7-trioxononanoic acid

C9H12O5 — CID 71399755

IUPAC3,5,7-trioxononanoic acid
SMILESCCC(=O)CC(=O)CC(=O)CC(=O)O
InChIInChI=1S/C9H12O5/c1-2-6(10)3-7(11)4-8(12)5-9(13)14/h2-5H2,1H3,(H,13,14)
InChIKeyOJKIUORTIUOJGN-UHFFFAOYSA-N
MW200.19 g/mol
LogP0.36
Rot. Bonds7

About 3,5,7-trioxononanoic acid

3,5,7-trioxononanoic acid (PubChem CID 71399755) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is 3,5,7-trioxononanoic acid.

Molecular Properties

Compound Name3,5,7-trioxononanoic acid
PubChem CID71399755
Molecular FormulaC9H12O5
Molecular Weight200.19 g/mol
Exact Mass200.07
IUPAC Name3,5,7-trioxononanoic acid
SMILESCCC(=O)CC(=O)CC(=O)CC(=O)O
InChIInChI=1S/C9H12O5/c1-2-6(10)3-7(11)4-8(12)5-9(13)14/h2-5H2,1H3,(H,13,14)
InChIKeyOJKIUORTIUOJGN-UHFFFAOYSA-N
XLogP0.36
TPSA88.51 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.19
LogP ≤ 50.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3,5,7-trioxononanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5,7-trioxononanoic acid?
The IUPAC name of 3,5,7-trioxononanoic acid (CID 71399755) is 3,5,7-trioxononanoic acid.
What is the SMILES notation for 3,5,7-trioxononanoic acid?
The canonical SMILES for 3,5,7-trioxononanoic acid is CCC(=O)CC(=O)CC(=O)CC(=O)O.
What is the InChIKey of 3,5,7-trioxononanoic acid?
The InChIKey is OJKIUORTIUOJGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O5/c1-2-6(10)3-7(11)4-8(12)5-9(13)14/h2-5H2,1H3,(H,13,14).
What are the key properties of 3,5,7-trioxononanoic acid?
3,5,7-trioxononanoic acid has a molecular weight of 200.19 g/mol, XLogP of 0.36, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,7-trioxononanoic acid is sourced from PubChem (CID 71399755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).