About heptane-3,5-dione;bis(hexan-3-one)
heptane-3,5-dione;bis(hexan-3-one) (PubChem CID 161435839) has the molecular formula C19H36O4
and a molecular weight of 328.49 g/mol. Its IUPAC name is heptane-3,5-dione;bis(hexan-3-one).
Molecular Properties
| Compound Name | heptane-3,5-dione;bis(hexan-3-one) |
| PubChem CID | 161435839 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | heptane-3,5-dione;bis(hexan-3-one) |
| SMILES | CCC(=O)CC(=O)CC.CCCC(=O)CC.CCCC(=O)CC |
| InChI | InChI=1S/C7H12O2.2C6H12O/c1-3-6(8)5-7(9)4-2;2*1-3-5-6(7)4-2/h3-5H2,1-2H3;2*3-5H2,1-2H3 |
| InChIKey | VYQCPYDNWGTYBV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze heptane-3,5-dione;bis(hexan-3-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane-3,5-dione;bis(hexan-3-one)?
The IUPAC name of heptane-3,5-dione;bis(hexan-3-one) (CID 161435839) is heptane-3,5-dione;bis(hexan-3-one).
What is the SMILES notation for heptane-3,5-dione;bis(hexan-3-one)?
The canonical SMILES for heptane-3,5-dione;bis(hexan-3-one) is CCC(=O)CC(=O)CC.CCCC(=O)CC.CCCC(=O)CC.
What is the InChIKey of heptane-3,5-dione;bis(hexan-3-one)?
The InChIKey is VYQCPYDNWGTYBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.2C6H12O/c1-3-6(8)5-7(9)4-2;2*1-3-5-6(7)4-2/h3-5H2,1-2H3;2*3-5H2,1-2H3.
What are the key properties of heptane-3,5-dione;bis(hexan-3-one)?
heptane-3,5-dione;bis(hexan-3-one) has a molecular weight of 328.49 g/mol, XLogP of 4.87, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for heptane-3,5-dione;bis(hexan-3-one) is sourced from PubChem (CID 161435839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).