About 9-ethylundecane-4,6-dione
9-ethylundecane-4,6-dione (PubChem CID 175392725) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 9-ethylundecane-4,6-dione.
Molecular Properties
| Compound Name | 9-ethylundecane-4,6-dione |
| PubChem CID | 175392725 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 9-ethylundecane-4,6-dione |
| SMILES | CCCC(=O)CC(=O)CCC(CC)CC |
| InChI | InChI=1S/C13H24O2/c1-4-7-12(14)10-13(15)9-8-11(5-2)6-3/h11H,4-10H2,1-3H3 |
| InChIKey | LIADGTNTMFOOBI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 9-ethylundecane-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethylundecane-4,6-dione?
The IUPAC name of 9-ethylundecane-4,6-dione (CID 175392725) is 9-ethylundecane-4,6-dione.
What is the SMILES notation for 9-ethylundecane-4,6-dione?
The canonical SMILES for 9-ethylundecane-4,6-dione is CCCC(=O)CC(=O)CCC(CC)CC.
What is the InChIKey of 9-ethylundecane-4,6-dione?
The InChIKey is LIADGTNTMFOOBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-4-7-12(14)10-13(15)9-8-11(5-2)6-3/h11H,4-10H2,1-3H3.
What are the key properties of 9-ethylundecane-4,6-dione?
9-ethylundecane-4,6-dione has a molecular weight of 212.33 g/mol, XLogP of 3.53, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethylundecane-4,6-dione is sourced from PubChem (CID 175392725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).