About 7-ethylnonan-4-one
7-ethylnonan-4-one (PubChem CID 537776) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is 7-ethylnonan-4-one.
Molecular Properties
| Compound Name | 7-ethylnonan-4-one |
| PubChem CID | 537776 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 7-ethylnonan-4-one |
| SMILES | CCCC(=O)CCC(CC)CC |
| InChI | InChI=1S/C11H22O/c1-4-7-11(12)9-8-10(5-2)6-3/h10H,4-9H2,1-3H3 |
| InChIKey | VKRGMUGBOKKSKN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-ethylnonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethylnonan-4-one?
The IUPAC name of 7-ethylnonan-4-one (CID 537776) is 7-ethylnonan-4-one.
What is the SMILES notation for 7-ethylnonan-4-one?
The canonical SMILES for 7-ethylnonan-4-one is CCCC(=O)CCC(CC)CC.
What is the InChIKey of 7-ethylnonan-4-one?
The InChIKey is VKRGMUGBOKKSKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-4-7-11(12)9-8-10(5-2)6-3/h10H,4-9H2,1-3H3.
What are the key properties of 7-ethylnonan-4-one?
7-ethylnonan-4-one has a molecular weight of 170.30 g/mol, XLogP of 3.57, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethylnonan-4-one is sourced from PubChem (CID 537776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).