About 2-methyl-5-oxooctanal
2-methyl-5-oxooctanal (PubChem CID 155026119) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 2-methyl-5-oxooctanal.
Molecular Properties
| Compound Name | 2-methyl-5-oxooctanal |
| PubChem CID | 155026119 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 2-methyl-5-oxooctanal |
| SMILES | CCCC(=O)CCC(C)C=O |
| InChI | InChI=1S/C9H16O2/c1-3-4-9(11)6-5-8(2)7-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | FQYDDYVUZWWYAX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-oxooctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-oxooctanal?
The IUPAC name of 2-methyl-5-oxooctanal (CID 155026119) is 2-methyl-5-oxooctanal.
What is the SMILES notation for 2-methyl-5-oxooctanal?
The canonical SMILES for 2-methyl-5-oxooctanal is CCCC(=O)CCC(C)C=O.
What is the InChIKey of 2-methyl-5-oxooctanal?
The InChIKey is FQYDDYVUZWWYAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-3-4-9(11)6-5-8(2)7-10/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-methyl-5-oxooctanal?
2-methyl-5-oxooctanal has a molecular weight of 156.22 g/mol, XLogP of 1.97, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-oxooctanal is sourced from PubChem (CID 155026119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).