About (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide
(4S)-N-iodo-N,4-dimethyl-5-oxopentanamide (PubChem CID 137393180) has the molecular formula C7H12INO2
and a molecular weight of 269.08 g/mol. Its IUPAC name is (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide.
Molecular Properties
| Compound Name | (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide |
| PubChem CID | 137393180 |
| Molecular Formula | C7H12INO2 |
| Molecular Weight | 269.08 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide |
| SMILES | CC(C=O)CCC(=O)N(C)I |
| InChI | InChI=1S/C7H12INO2/c1-6(5-10)3-4-7(11)9(2)8/h5-6H,3-4H2,1-2H3 |
| InChIKey | COMOYHPWIGNTJE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.08 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide?
The IUPAC name of (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide (CID 137393180) is (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide.
What is the SMILES notation for (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide?
The canonical SMILES for (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide is CC(C=O)CCC(=O)N(C)I.
What is the InChIKey of (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide?
The InChIKey is COMOYHPWIGNTJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12INO2/c1-6(5-10)3-4-7(11)9(2)8/h5-6H,3-4H2,1-2H3.
What are the key properties of (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide?
(4S)-N-iodo-N,4-dimethyl-5-oxopentanamide has a molecular weight of 269.08 g/mol, XLogP of 1.41, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-N-iodo-N,4-dimethyl-5-oxopentanamide is sourced from PubChem (CID 137393180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).