C14H24O2 — CID 101143441
2,6,10-trimethyl-5-oxoundec-9-enal (PubChem CID 101143441) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 2,6,10-trimethyl-5-oxoundec-9-enal.
| Compound Name | 2,6,10-trimethyl-5-oxoundec-9-enal |
|---|---|
| PubChem CID | 101143441 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2,6,10-trimethyl-5-oxoundec-9-enal |
| SMILES | CC(C)=CCCC(C)C(=O)CCC(C)C=O |
| InChI | InChI=1S/C14H24O2/c1-11(2)6-5-7-13(4)14(16)9-8-12(3)10-15/h6,10,12-13H,5,7-9H2,1-4H3 |
| InChIKey | SZLATXFZTSXLII-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|