C18H32O2 — CID 158364508
2,6-dimethylhept-5-enal (PubChem CID 158364508) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 2,6-dimethylhept-5-enal.
| Compound Name | 2,6-dimethylhept-5-enal |
|---|---|
| PubChem CID | 158364508 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 2,6-dimethylhept-5-enal |
| SMILES | CC(C)=CCCC(C)C=O.CC(C)=CCCC(C)C=O |
| InChI | InChI=1S/2C9H16O/c2*1-8(2)5-4-6-9(3)7-10/h2*5,7,9H,4,6H2,1-3H3 |
| InChIKey | GTWAZDWMBYWOLO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|