C10H18O2 — CID 15409470
1-hydroxy-3,7-dimethyloct-6-en-2-one (PubChem CID 15409470) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 1-hydroxy-3,7-dimethyloct-6-en-2-one.
| Compound Name | 1-hydroxy-3,7-dimethyloct-6-en-2-one |
|---|---|
| PubChem CID | 15409470 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 1-hydroxy-3,7-dimethyloct-6-en-2-one |
| SMILES | CC(C)=CCCC(C)C(=O)CO |
| InChI | InChI=1S/C10H18O2/c1-8(2)5-4-6-9(3)10(12)7-11/h5,9,11H,4,6-7H2,1-3H3 |
| InChIKey | GILUWVHMCQOOCM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|