About 6-methylhept-5-en-2-yl propanoate
6-methylhept-5-en-2-yl propanoate (PubChem CID 3020294) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 6-methylhept-5-en-2-yl propanoate.
Molecular Properties
| Compound Name | 6-methylhept-5-en-2-yl propanoate |
| PubChem CID | 3020294 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 6-methylhept-5-en-2-yl propanoate |
| SMILES | CCC(=O)OC(C)CCC=C(C)C |
| InChI | InChI=1S/C11H20O2/c1-5-11(12)13-10(4)8-6-7-9(2)3/h7,10H,5-6,8H2,1-4H3 |
| InChIKey | QTQUCFACVUKEDR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methylhept-5-en-2-yl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylhept-5-en-2-yl propanoate?
The IUPAC name of 6-methylhept-5-en-2-yl propanoate (CID 3020294) is 6-methylhept-5-en-2-yl propanoate.
What is the SMILES notation for 6-methylhept-5-en-2-yl propanoate?
The canonical SMILES for 6-methylhept-5-en-2-yl propanoate is CCC(=O)OC(C)CCC=C(C)C.
What is the InChIKey of 6-methylhept-5-en-2-yl propanoate?
The InChIKey is QTQUCFACVUKEDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-5-11(12)13-10(4)8-6-7-9(2)3/h7,10H,5-6,8H2,1-4H3.
What are the key properties of 6-methylhept-5-en-2-yl propanoate?
6-methylhept-5-en-2-yl propanoate has a molecular weight of 184.28 g/mol, XLogP of 3.07, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylhept-5-en-2-yl propanoate is sourced from PubChem (CID 3020294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).