C22H38O2 — CID 147657176
[(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] butanoate (PubChem CID 147657176) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] butanoate.
| Compound Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] butanoate |
|---|---|
| PubChem CID | 147657176 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] butanoate |
| SMILES | CCCC(=O)OC(C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H38O2/c1-7-11-22(23)24-21(6)17-10-16-20(5)15-9-14-19(4)13-8-12-18(2)3/h12,14,16,21H,7-11,13,15,17H2,1-6H3/b19-14+,20-16+ |
| InChIKey | GKQDPRPJVIVJCM-XHGFWWIISA-N |
| XLogP | 6.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|