C27H46O2 — CID 149399642
[(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 2-cycloheptylacetate (PubChem CID 149399642) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 2-cycloheptylacetate.
| Compound Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 2-cycloheptylacetate |
|---|---|
| PubChem CID | 149399642 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 2-cycloheptylacetate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(C)OC(=O)CC1CCCCCC1 |
| InChI | InChI=1S/C27H46O2/c1-22(2)13-10-14-23(3)15-11-16-24(4)17-12-18-25(5)29-27(28)21-26-19-8-6-7-9-20-26/h13,15,17,25-26H,6-12,14,16,18-21H2,1-5H3/b23-15+,24-17+ |
| InChIKey | YPDDVXRWSFYHCY-LRMXHFNYSA-N |
| XLogP | 8.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|