C23H40O2 — CID 146825846
[(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 3-methylbutanoate (PubChem CID 146825846) has the molecular formula C23H40O2 and a molecular weight of 348.57 g/mol. Its IUPAC name is [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 3-methylbutanoate.
| Compound Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 146825846 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 3-methylbutanoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(C)OC(=O)CC(C)C |
| InChI | InChI=1S/C23H40O2/c1-18(2)11-8-12-20(5)13-9-14-21(6)15-10-16-22(7)25-23(24)17-19(3)4/h11,13,15,19,22H,8-10,12,14,16-17H2,1-7H3/b20-13+,21-15+ |
| InChIKey | SCYLTIZTMMKZGW-RSKMIKRQSA-N |
| XLogP | 7.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|