C25H43NO2 — CID 89476445
[(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] N-cyclohexylcarbamate (PubChem CID 89476445) has the molecular formula C25H43NO2 and a molecular weight of 389.62 g/mol. Its IUPAC name is [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] N-cyclohexylcarbamate.
| Compound Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 89476445 |
| Molecular Formula | C25H43NO2 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.33 |
| IUPAC Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] N-cyclohexylcarbamate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(C)OC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C25H43NO2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-17-23(5)28-25(27)26-24-18-7-6-8-19-24/h12,14,16,23-24H,6-11,13,15,17-19H2,1-5H3,(H,26,27)/b21-14+,22-16+ |
| InChIKey | SKTUWAMUHXQNJS-KTWAZNHYSA-N |
| XLogP | 7.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|