C17H31NO — CID 70435115
(3E)-1-(cyclohexylamino)-4,8-dimethylnona-3,7-dien-2-ol (PubChem CID 70435115) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is (3E)-1-(cyclohexylamino)-4,8-dimethylnona-3,7-dien-2-ol.
| Compound Name | (3E)-1-(cyclohexylamino)-4,8-dimethylnona-3,7-dien-2-ol |
|---|---|
| PubChem CID | 70435115 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (3E)-1-(cyclohexylamino)-4,8-dimethylnona-3,7-dien-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/C(O)CNC1CCCCC1 |
| InChI | InChI=1S/C17H31NO/c1-14(2)8-7-9-15(3)12-17(19)13-18-16-10-5-4-6-11-16/h8,12,16-19H,4-7,9-11,13H2,1-3H3/b15-12+ |
| InChIKey | OJXBVACQGFDNSD-NTCAYCPXSA-N |
| XLogP | 3.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|