C33H58BrP — CID 160956477
tricyclohexyl(3,7,11-trimethyldodeca-2,6,10-trienyl)phosphanium bromide (PubChem CID 160956477) has the molecular formula C33H58BrP and a molecular weight of 565.71 g/mol. Its IUPAC name is tricyclohexyl(3,7,11-trimethyldodeca-2,6,10-trienyl)phosphanium bromide.
| Compound Name | tricyclohexyl(3,7,11-trimethyldodeca-2,6,10-trienyl)phosphanium bromide |
|---|---|
| PubChem CID | 160956477 |
| Molecular Formula | C33H58BrP |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 564.35 |
| IUPAC Name | tricyclohexyl(3,7,11-trimethyldodeca-2,6,10-trienyl)phosphanium bromide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC[P+](C1CCCCC1)(C1CCCCC1)C1CCCCC1.[Br-] |
| InChI | InChI=1S/C33H58P.BrH/c1-28(2)16-14-17-29(3)18-15-19-30(4)26-27-34(31-20-8-5-9-21-31,32-22-10-6-11-23-32)33-24-12-7-13-25-33;/h16,18,26,31-33H,5-15,17,19-25,27H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | SWLKPAMVZGFWLZ-UHFFFAOYSA-M |
| XLogP | 8.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|