C17H31N — CID 124676145
(1S,3E)-1-cyclohexyl-4,8-dimethylnona-3,7-dien-1-amine (PubChem CID 124676145) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is (1S,3E)-1-cyclohexyl-4,8-dimethylnona-3,7-dien-1-amine.
| Compound Name | (1S,3E)-1-cyclohexyl-4,8-dimethylnona-3,7-dien-1-amine |
|---|---|
| PubChem CID | 124676145 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | (1S,3E)-1-cyclohexyl-4,8-dimethylnona-3,7-dien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/C[C@H](N)C1CCCCC1 |
| InChI | InChI=1S/C17H31N/c1-14(2)8-7-9-15(3)12-13-17(18)16-10-5-4-6-11-16/h8,12,16-17H,4-7,9-11,13,18H2,1-3H3/b15-12+/t17-/m0/s1 |
| InChIKey | TYKZEBDQWJLYGF-VMEIHUARSA-N |
| XLogP | 4.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|