C26H45N — CID 154452544
1-[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]azepane (PubChem CID 154452544) has the molecular formula C26H45N and a molecular weight of 371.65 g/mol. Its IUPAC name is 1-[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]azepane.
| Compound Name | 1-[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]azepane |
|---|---|
| PubChem CID | 154452544 |
| Molecular Formula | C26H45N |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 371.36 |
| IUPAC Name | 1-[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]azepane |
| SMILES | CC(C)=CCC/C(C)=C/CC(/C=C(\C)CCC=C(C)C)N1CCCCCC1 |
| InChI | InChI=1S/C26H45N/c1-22(2)13-11-15-24(5)17-18-26(27-19-9-7-8-10-20-27)21-25(6)16-12-14-23(3)4/h13-14,17,21,26H,7-12,15-16,18-20H2,1-6H3/b24-17+,25-21+ |
| InChIKey | LNOJZIQGHRVZQU-IFNFAZRXSA-N |
| XLogP | 8.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|