C17H27NO6 — CID 167312524
4-O-[2-(cyclohexylcarbamoyloxy)-3-methylbutyl] 1-O-methyl but-2-enedioate (PubChem CID 167312524) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is 4-O-[2-(cyclohexylcarbamoyloxy)-3-methylbutyl] 1-O-methyl but-2-enedioate.
| Compound Name | 4-O-[2-(cyclohexylcarbamoyloxy)-3-methylbutyl] 1-O-methyl but-2-enedioate |
|---|---|
| PubChem CID | 167312524 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 4-O-[2-(cyclohexylcarbamoyloxy)-3-methylbutyl] 1-O-methyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OCC(OC(=O)NC1CCCCC1)C(C)C |
| InChI | InChI=1S/C17H27NO6/c1-12(2)14(11-23-16(20)10-9-15(19)22-3)24-17(21)18-13-7-5-4-6-8-13/h9-10,12-14H,4-8,11H2,1-3H3,(H,18,21) |
| InChIKey | FSFBAZLNPQLNBK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|