C15H26O3 — CID 11043303
[(5E,9E)-11-hydroxy-6,10-dimethylundeca-5,9-dien-2-yl] acetate (PubChem CID 11043303) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is [(5E,9E)-11-hydroxy-6,10-dimethylundeca-5,9-dien-2-yl] acetate.
| Compound Name | [(5E,9E)-11-hydroxy-6,10-dimethylundeca-5,9-dien-2-yl] acetate |
|---|---|
| PubChem CID | 11043303 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | [(5E,9E)-11-hydroxy-6,10-dimethylundeca-5,9-dien-2-yl] acetate |
| SMILES | CC(=O)OC(C)CC/C=C(\C)CC/C=C(\C)CO |
| InChI | InChI=1S/C15H26O3/c1-12(7-5-9-13(2)11-16)8-6-10-14(3)18-15(4)17/h8-9,14,16H,5-7,10-11H2,1-4H3/b12-8+,13-9+ |
| InChIKey | RIEAXYSWBQKTOD-QHKWOANTSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|