C33H58O8 — CID 157489069
[(5Z,9E)-11-hydroxy-3,6,10-trimethyl-2-oxoundeca-5,9-dien-3-yl] acetate;[(Z,10S)-11-hydroxy-3,6,10-trimethyl-2-oxoundec-5-en-3-yl] acetate;methane (PubChem CID 157489069) has the molecular formula C33H58O8 and a molecular weight of 582.82 g/mol. Its IUPAC name is [(5Z,9E)-11-hydroxy-3,6,10-trimethyl-2-oxoundeca-5,9-dien-3-yl] acetate;[(Z,10S)-11-hydroxy-3,6,10-trimethyl-2-oxoundec-5-en-3-yl] acetate;methane.
| Compound Name | [(5Z,9E)-11-hydroxy-3,6,10-trimethyl-2-oxoundeca-5,9-dien-3-yl] acetate;[(Z,10S)-11-hydroxy-3,6,10-trimethyl-2-oxoundec-5-en-3-yl] acetate;methane |
|---|---|
| PubChem CID | 157489069 |
| Molecular Formula | C33H58O8 |
| Molecular Weight | 582.82 g/mol |
| Exact Mass | 582.41 |
| IUPAC Name | [(5Z,9E)-11-hydroxy-3,6,10-trimethyl-2-oxoundeca-5,9-dien-3-yl] acetate;[(Z,10S)-11-hydroxy-3,6,10-trimethyl-2-oxoundec-5-en-3-yl] acetate;methane |
| SMILES | C.CC(=O)OC(C)(C/C=C(/C)CC/C=C(\C)CO)C(C)=O.CC(=O)OC(C)(C/C=C(/C)CCC[C@H](C)CO)C(C)=O |
| InChI | InChI=1S/C16H28O4.C16H26O4.CH4/c2*1-12(7-6-8-13(2)11-17)9-10-16(5,14(3)18)20-15(4)19;/h9,13,17H,6-8,10-11H2,1-5H3;8-9,17H,6-7,10-11H2,1-5H3;1H4/b12-9-;12-9-,13-8+;/t13-,16?;;/m0../s1 |
| InChIKey | BXBBQXNPNKHDAF-BPCDNIMTSA-N |
| XLogP | 6.62 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.82 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|