C24H48N2O2 — CID 144859911
ethane;N-methoxymethanamine;(6Z,10E,12Z)-2,6,10-trimethyl-12-(propan-2-ylideneamino)tetradeca-6,10,12-trien-1-ol (PubChem CID 144859911) has the molecular formula C24H48N2O2 and a molecular weight of 396.66 g/mol. Its IUPAC name is ethane;N-methoxymethanamine;(6Z,10E,12Z)-2,6,10-trimethyl-12-(propan-2-ylideneamino)tetradeca-6,10,12-trien-1-ol.
| Compound Name | ethane;N-methoxymethanamine;(6Z,10E,12Z)-2,6,10-trimethyl-12-(propan-2-ylideneamino)tetradeca-6,10,12-trien-1-ol |
|---|---|
| PubChem CID | 144859911 |
| Molecular Formula | C24H48N2O2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.37 |
| IUPAC Name | ethane;N-methoxymethanamine;(6Z,10E,12Z)-2,6,10-trimethyl-12-(propan-2-ylideneamino)tetradeca-6,10,12-trien-1-ol |
| SMILES | C/C=C(/C=C(\C)CC/C=C(/C)CCCC(C)CO)N=C(C)C.CC.CNOC |
| InChI | InChI=1S/C20H35NO.C2H7NO.C2H6/c1-7-20(21-16(2)3)14-18(5)12-8-10-17(4)11-9-13-19(6)15-22;1-3-4-2;1-2/h7,10,14,19,22H,8-9,11-13,15H2,1-6H3;3H,1-2H3;1-2H3/b17-10-,18-14+,20-7-;; |
| InChIKey | QVBQJHYRBGKTQZ-ZEIOBUASSA-N |
| XLogP | 6.64 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|