C31H59NO3S2 — CID 142900321
ethane;formic acid;5-methyl-5-[(8Z,12E,14Z)-4,8,12-trimethyl-14-(propan-2-ylideneamino)-15-sulfanylpentadeca-8,12,14-trien-2-yl]sulfanylhexan-3-ol (PubChem CID 142900321) has the molecular formula C31H59NO3S2 and a molecular weight of 557.95 g/mol. Its IUPAC name is ethane;formic acid;5-methyl-5-[(8Z,12E,14Z)-4,8,12-trimethyl-14-(propan-2-ylideneamino)-15-sulfanylpentadeca-8,12,14-trien-2-yl]sulfanylhexan-3-ol.
| Compound Name | ethane;formic acid;5-methyl-5-[(8Z,12E,14Z)-4,8,12-trimethyl-14-(propan-2-ylideneamino)-15-sulfanylpentadeca-8,12,14-trien-2-yl]sulfanylhexan-3-ol |
|---|---|
| PubChem CID | 142900321 |
| Molecular Formula | C31H59NO3S2 |
| Molecular Weight | 557.95 g/mol |
| Exact Mass | 557.39 |
| IUPAC Name | ethane;formic acid;5-methyl-5-[(8Z,12E,14Z)-4,8,12-trimethyl-14-(propan-2-ylideneamino)-15-sulfanylpentadeca-8,12,14-trien-2-yl]sulfanylhexan-3-ol |
| SMILES | CC.CCC(O)CC(C)(C)SC(C)CC(C)CCC/C(C)=C\CC/C(C)=C/C(=C/S)N=C(C)C.O=CO |
| InChI | InChI=1S/C28H51NOS2.C2H6.CH2O2/c1-10-27(30)19-28(8,9)32-25(7)17-23(5)15-11-13-22(4)14-12-16-24(6)18-26(20-31)29-21(2)3;1-2;2-1-3/h14,18,20,23,25,27,30-31H,10-13,15-17,19H2,1-9H3;1-2H3;1H,(H,2,3)/b22-14-,24-18+,26-20-;; |
| InChIKey | NEXBSSGPCFLGHR-JLCJERLSSA-N |
| XLogP | 9.90 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.95 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|