C15H30 — CID 91025564
7,11-dimethyltridec-6-ene (PubChem CID 91025564) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is 7,11-dimethyltridec-6-ene.
| Compound Name | 7,11-dimethyltridec-6-ene |
|---|---|
| PubChem CID | 91025564 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 7,11-dimethyltridec-6-ene |
| SMILES | CCCCCC=C(C)CCCC(C)CC |
| InChI | InChI=1S/C15H30/c1-5-7-8-9-11-15(4)13-10-12-14(3)6-2/h11,14H,5-10,12-13H2,1-4H3 |
| InChIKey | POXBTFJQEYCZKX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|