C26H44O2 — CID 148829427
[(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 2-cyclohexylacetate (PubChem CID 148829427) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 2-cyclohexylacetate.
| Compound Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 2-cyclohexylacetate |
|---|---|
| PubChem CID | 148829427 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-yl] 2-cyclohexylacetate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(C)OC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C26H44O2/c1-21(2)12-9-13-22(3)14-10-15-23(4)16-11-17-24(5)28-26(27)20-25-18-7-6-8-19-25/h12,14,16,24-25H,6-11,13,15,17-20H2,1-5H3/b22-14+,23-16+ |
| InChIKey | OTJMQGFJHHGFHI-SUMSNFAJSA-N |
| XLogP | 8.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|