C21H34O2 — CID 155213089
methyl (5E,9E)-11-cyclohexyl-6,10-dimethyl-2-methylideneundeca-5,9-dienoate (PubChem CID 155213089) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is methyl (5E,9E)-11-cyclohexyl-6,10-dimethyl-2-methylideneundeca-5,9-dienoate.
| Compound Name | methyl (5E,9E)-11-cyclohexyl-6,10-dimethyl-2-methylideneundeca-5,9-dienoate |
|---|---|
| PubChem CID | 155213089 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | methyl (5E,9E)-11-cyclohexyl-6,10-dimethyl-2-methylideneundeca-5,9-dienoate |
| SMILES | C=C(CC/C=C(\C)CC/C=C(\C)CC1CCCCC1)C(=O)OC |
| InChI | InChI=1S/C21H34O2/c1-17(11-9-13-19(3)21(22)23-4)10-8-12-18(2)16-20-14-6-5-7-15-20/h11-12,20H,3,5-10,13-16H2,1-2,4H3/b17-11+,18-12+ |
| InChIKey | MRVVNIARDROIJO-JYFOCSDGSA-N |
| XLogP | 6.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|