About methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate
methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate (PubChem CID 175495445) has the molecular formula C27H46O4
and a molecular weight of 434.66 g/mol. Its IUPAC name is methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate |
| PubChem CID | 175495445 |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate |
| SMILES | C=C(CC1CCCCCCC1)C(=O)OC.COC(=O)C(C)=CCC1CCCCCCC1 |
| InChI | InChI=1S/C14H24O2.C13H22O2/c1-12(14(15)16-2)10-11-13-8-6-4-3-5-7-9-13;1-11(13(14)15-2)10-12-8-6-4-3-5-7-9-12/h10,13H,3-9,11H2,1-2H3;12H,1,3-10H2,2H3 |
| InChIKey | APXNKMWGQNGXHZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate?
The IUPAC name of methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate (CID 175495445) is methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate.
What is the SMILES notation for methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate?
The canonical SMILES for methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate is C=C(CC1CCCCCCC1)C(=O)OC.COC(=O)C(C)=CCC1CCCCCCC1.
What is the InChIKey of methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate?
The InChIKey is APXNKMWGQNGXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2.C13H22O2/c1-12(14(15)16-2)10-11-13-8-6-4-3-5-7-9-13;1-11(13(14)15-2)10-12-8-6-4-3-5-7-9-12/h10,13H,3-9,11H2,1-2H3;12H,1,3-10H2,2H3.
What are the key properties of methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate?
methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate has a molecular weight of 434.66 g/mol, XLogP of 7.32, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-cyclooctyl-2-methylbut-2-enoate;methyl 2-(cyclooctylmethyl)prop-2-enoate is sourced from PubChem (CID 175495445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).