C13H24N2O2 — CID 103244427
methyl 2-methyl-4-[(1-methylpiperidin-3-yl)methylamino]but-2-enoate (PubChem CID 103244427) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is methyl 2-methyl-4-[(1-methylpiperidin-3-yl)methylamino]but-2-enoate.
| Compound Name | methyl 2-methyl-4-[(1-methylpiperidin-3-yl)methylamino]but-2-enoate |
|---|---|
| PubChem CID | 103244427 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | methyl 2-methyl-4-[(1-methylpiperidin-3-yl)methylamino]but-2-enoate |
| SMILES | COC(=O)C(C)=CCNCC1CCCN(C)C1 |
| InChI | InChI=1S/C13H24N2O2/c1-11(13(16)17-3)6-7-14-9-12-5-4-8-15(2)10-12/h6,12,14H,4-5,7-10H2,1-3H3 |
| InChIKey | IVKFUBURHHCTDX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|