C10H18N2O2 — CID 103239678
methyl (E)-3-[(1-methylpyrrolidin-3-yl)methylamino]prop-2-enoate (PubChem CID 103239678) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is methyl (E)-3-[(1-methylpyrrolidin-3-yl)methylamino]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1-methylpyrrolidin-3-yl)methylamino]prop-2-enoate |
|---|---|
| PubChem CID | 103239678 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | methyl (E)-3-[(1-methylpyrrolidin-3-yl)methylamino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NCC1CCN(C)C1 |
| InChI | InChI=1S/C10H18N2O2/c1-12-6-4-9(8-12)7-11-5-3-10(13)14-2/h3,5,9,11H,4,6-8H2,1-2H3/b5-3+ |
| InChIKey | DXNHBLDYUFJFID-HWKANZROSA-N |
| XLogP | 0.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|