C11H18N2O3 — CID 103263221
methyl (E)-3-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]prop-2-enoate (PubChem CID 103263221) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is methyl (E)-3-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]prop-2-enoate.
| Compound Name | methyl (E)-3-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 103263221 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | methyl (E)-3-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C11H18N2O3/c1-16-11(15)5-7-12-6-4-10(14)13-8-2-3-9-13/h5,7,12H,2-4,6,8-9H2,1H3/b7-5+ |
| InChIKey | UZRDMGWPLCWJPY-FNORWQNLSA-N |
| XLogP | 0.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|