C12H22N2O2 — CID 103266972
methyl (E)-3-[2-(1-methylpiperidin-4-yl)ethylamino]prop-2-enoate (PubChem CID 103266972) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is methyl (E)-3-[2-(1-methylpiperidin-4-yl)ethylamino]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-(1-methylpiperidin-4-yl)ethylamino]prop-2-enoate |
|---|---|
| PubChem CID | 103266972 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | methyl (E)-3-[2-(1-methylpiperidin-4-yl)ethylamino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NCCC1CCN(C)CC1 |
| InChI | InChI=1S/C12H22N2O2/c1-14-9-5-11(6-10-14)3-7-13-8-4-12(15)16-2/h4,8,11,13H,3,5-7,9-10H2,1-2H3/b8-4+ |
| InChIKey | FOGHTDCFAOTQME-XBXARRHUSA-N |
| XLogP | 0.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|