C12H26N2O — CID 145305078
ethane;N-[2-(1-methylpiperidin-4-yl)ethyl]acetamide (PubChem CID 145305078) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is ethane;N-[2-(1-methylpiperidin-4-yl)ethyl]acetamide.
| Compound Name | ethane;N-[2-(1-methylpiperidin-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 145305078 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | ethane;N-[2-(1-methylpiperidin-4-yl)ethyl]acetamide |
| SMILES | CC.CC(=O)NCCC1CCN(C)CC1 |
| InChI | InChI=1S/C10H20N2O.C2H6/c1-9(13)11-6-3-10-4-7-12(2)8-5-10;1-2/h10H,3-8H2,1-2H3,(H,11,13);1-2H3 |
| InChIKey | FTUXVGYGVMHIOX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |