C11H17F3N2O3 — CID 68877986
[4-(2-acetamidoethyl)piperidin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 68877986) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is [4-(2-acetamidoethyl)piperidin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-(2-acetamidoethyl)piperidin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68877986 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | [4-(2-acetamidoethyl)piperidin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(=O)NCCC1CCN(OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3N2O3/c1-8(17)15-5-2-9-3-6-16(7-4-9)19-10(18)11(12,13)14/h9H,2-7H2,1H3,(H,15,17) |
| InChIKey | XCVQPDNROJIGTG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |