C9H17NO2 — CID 163743916
N-[2-[(3R)-3-hydroxycyclopentyl]ethyl]acetamide (PubChem CID 163743916) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is N-[2-[(3R)-3-hydroxycyclopentyl]ethyl]acetamide.
| Compound Name | N-[2-[(3R)-3-hydroxycyclopentyl]ethyl]acetamide |
|---|---|
| PubChem CID | 163743916 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | N-[2-[(3R)-3-hydroxycyclopentyl]ethyl]acetamide |
| SMILES | CC(=O)NCCC1CC[C@@H](O)C1 |
| InChI | InChI=1S/C9H17NO2/c1-7(11)10-5-4-8-2-3-9(12)6-8/h8-9,12H,2-6H2,1H3,(H,10,11)/t8?,9-/m1/s1 |
| InChIKey | LKDVWKNRAPGSIN-YGPZHTELSA-N |
| XLogP | 0.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |