About [3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate
[3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 146272877) has the molecular formula C9H12F3NO3
and a molecular weight of 239.19 g/mol. Its IUPAC name is [3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate.
Analyze [3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate?
The IUPAC name of [3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate (CID 146272877) is [3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate.
What is the SMILES notation for [3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate?
The canonical SMILES for [3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate is O=C(ON1CC(OCC2CC2)C1)C(F)(F)F.
What is the InChIKey of [3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate?
The InChIKey is NDKNJFQXEINIEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO3/c10-9(11,12)8(14)16-13-3-7(4-13)15-5-6-1-2-6/h6-7H,1-5H2.
What are the key properties of [3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate?
[3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate has a molecular weight of 239.19 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(cyclopropylmethoxy)azetidin-1-yl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 146272877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).