About (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate
(2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate (PubChem CID 68841732) has the molecular formula C7H10F3NO3
and a molecular weight of 213.15 g/mol. Its IUPAC name is (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate |
| PubChem CID | 68841732 |
| Molecular Formula | C7H10F3NO3 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate |
| SMILES | CC1CN(OC(=O)C(F)(F)F)CCO1 |
| InChI | InChI=1S/C7H10F3NO3/c1-5-4-11(2-3-13-5)14-6(12)7(8,9)10/h5H,2-4H2,1H3 |
| InChIKey | YTUOFSRDOUIJDF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate?
The IUPAC name of (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate (CID 68841732) is (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate.
What is the SMILES notation for (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate?
The canonical SMILES for (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate is CC1CN(OC(=O)C(F)(F)F)CCO1.
What is the InChIKey of (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate?
The InChIKey is YTUOFSRDOUIJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3NO3/c1-5-4-11(2-3-13-5)14-6(12)7(8,9)10/h5H,2-4H2,1H3.
What are the key properties of (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate?
(2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate has a molecular weight of 213.15 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylmorpholin-4-yl) 2,2,2-trifluoroacetate is sourced from PubChem (CID 68841732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).