C7H17NO2 — CID 156729518
2,4-dimethylmorpholine;methanol (PubChem CID 156729518) has the molecular formula C7H17NO2 and a molecular weight of 147.22 g/mol. Its IUPAC name is 2,4-dimethylmorpholine;methanol.
| Compound Name | 2,4-dimethylmorpholine;methanol |
|---|---|
| PubChem CID | 156729518 |
| Molecular Formula | C7H17NO2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | 2,4-dimethylmorpholine;methanol |
| SMILES | CC1CN(C)CCO1.CO |
| InChI | InChI=1S/C6H13NO.CH4O/c1-6-5-7(2)3-4-8-6;1-2/h6H,3-5H2,1-2H3;2H,1H3 |
| InChIKey | RQNPMCBIDNYQPI-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |