About 4-methylmorpholin-2-ol;hydrate
4-methylmorpholin-2-ol;hydrate (PubChem CID 175404438) has the molecular formula C5H13NO3
and a molecular weight of 135.16 g/mol. Its IUPAC name is 4-methylmorpholin-2-ol;hydrate.
Molecular Properties
| Compound Name | 4-methylmorpholin-2-ol;hydrate |
| PubChem CID | 175404438 |
| Molecular Formula | C5H13NO3 |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 4-methylmorpholin-2-ol;hydrate |
| SMILES | CN1CCOC(O)C1.O |
| InChI | InChI=1S/C5H11NO2.H2O/c1-6-2-3-8-5(7)4-6;/h5,7H,2-4H2,1H3;1H2 |
| InChIKey | BRZGRIIBMSHTKZ-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 64.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylmorpholin-2-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylmorpholin-2-ol;hydrate?
The IUPAC name of 4-methylmorpholin-2-ol;hydrate (CID 175404438) is 4-methylmorpholin-2-ol;hydrate.
What is the SMILES notation for 4-methylmorpholin-2-ol;hydrate?
The canonical SMILES for 4-methylmorpholin-2-ol;hydrate is CN1CCOC(O)C1.O.
What is the InChIKey of 4-methylmorpholin-2-ol;hydrate?
The InChIKey is BRZGRIIBMSHTKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.H2O/c1-6-2-3-8-5(7)4-6;/h5,7H,2-4H2,1H3;1H2.
What are the key properties of 4-methylmorpholin-2-ol;hydrate?
4-methylmorpholin-2-ol;hydrate has a molecular weight of 135.16 g/mol, XLogP of -1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylmorpholin-2-ol;hydrate is sourced from PubChem (CID 175404438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).