About 4-propylmorpholin-2-ol
4-propylmorpholin-2-ol (PubChem CID 126640355) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 4-propylmorpholin-2-ol.
Molecular Properties
| Compound Name | 4-propylmorpholin-2-ol |
| PubChem CID | 126640355 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 4-propylmorpholin-2-ol |
| SMILES | CCCN1CCOC(O)C1 |
| InChI | InChI=1S/C7H15NO2/c1-2-3-8-4-5-10-7(9)6-8/h7,9H,2-6H2,1H3 |
| InChIKey | BBJIVSAPNNBONH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propylmorpholin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propylmorpholin-2-ol?
The IUPAC name of 4-propylmorpholin-2-ol (CID 126640355) is 4-propylmorpholin-2-ol.
What is the SMILES notation for 4-propylmorpholin-2-ol?
The canonical SMILES for 4-propylmorpholin-2-ol is CCCN1CCOC(O)C1.
What is the InChIKey of 4-propylmorpholin-2-ol?
The InChIKey is BBJIVSAPNNBONH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-2-3-8-4-5-10-7(9)6-8/h7,9H,2-6H2,1H3.
What are the key properties of 4-propylmorpholin-2-ol?
4-propylmorpholin-2-ol has a molecular weight of 145.20 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propylmorpholin-2-ol is sourced from PubChem (CID 126640355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).