About (4-methylmorpholine-2-carbonyl)-λ2-stannane
(4-methylmorpholine-2-carbonyl)-λ2-stannane (PubChem CID 174736409) has the molecular formula C6H11NO2Sn
and a molecular weight of 247.87 g/mol. Its IUPAC name is (4-methylmorpholine-2-carbonyl)-λ2-stannane.
Molecular Properties
| Compound Name | (4-methylmorpholine-2-carbonyl)-λ2-stannane |
| PubChem CID | 174736409 |
| Molecular Formula | C6H11NO2Sn |
| Molecular Weight | 247.87 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | (4-methylmorpholine-2-carbonyl)-λ2-stannane |
| SMILES | CN1CCOC(C(=O)[SnH])C1 |
| InChI | InChI=1S/C6H10NO2.Sn.H/c1-7-2-3-9-6(4-7)5-8;;/h6H,2-4H2,1H3;; |
| InChIKey | JDXAFVYUNQHAAN-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.87 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methylmorpholine-2-carbonyl)-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylmorpholine-2-carbonyl)-λ2-stannane?
The IUPAC name of (4-methylmorpholine-2-carbonyl)-λ2-stannane (CID 174736409) is (4-methylmorpholine-2-carbonyl)-λ2-stannane.
What is the SMILES notation for (4-methylmorpholine-2-carbonyl)-λ2-stannane?
The canonical SMILES for (4-methylmorpholine-2-carbonyl)-λ2-stannane is CN1CCOC(C(=O)[SnH])C1.
What is the InChIKey of (4-methylmorpholine-2-carbonyl)-λ2-stannane?
The InChIKey is JDXAFVYUNQHAAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10NO2.Sn.H/c1-7-2-3-9-6(4-7)5-8;;/h6H,2-4H2,1H3;;.
What are the key properties of (4-methylmorpholine-2-carbonyl)-λ2-stannane?
(4-methylmorpholine-2-carbonyl)-λ2-stannane has a molecular weight of 247.87 g/mol, XLogP of -1.26, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylmorpholine-2-carbonyl)-λ2-stannane is sourced from PubChem (CID 174736409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).