C15H26N2O2 — CID 71925438
(2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(4-methylmorpholin-2-yl)methanone (PubChem CID 71925438) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is (2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(4-methylmorpholin-2-yl)methanone.
| Compound Name | (2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(4-methylmorpholin-2-yl)methanone |
|---|---|
| PubChem CID | 71925438 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(4-methylmorpholin-2-yl)methanone |
| SMILES | CC1CC2CCCCC2N1C(=O)C1CN(C)CCO1 |
| InChI | InChI=1S/C15H26N2O2/c1-11-9-12-5-3-4-6-13(12)17(11)15(18)14-10-16(2)7-8-19-14/h11-14H,3-10H2,1-2H3 |
| InChIKey | PPPKUAGWBDLNDU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |