C16H25NO — CID 71930686
cyclohex-3-en-1-yl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methanone (PubChem CID 71930686) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methanone.
| Compound Name | cyclohex-3-en-1-yl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 71930686 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | cyclohex-3-en-1-yl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methanone |
| SMILES | CC1CC2CCCCC2N1C(=O)C1CC=CCC1 |
| InChI | InChI=1S/C16H25NO/c1-12-11-14-9-5-6-10-15(14)17(12)16(18)13-7-3-2-4-8-13/h2-3,12-15H,4-11H2,1H3 |
| InChIKey | ITMMJZSWUWICQF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|