C19H22N2O3 — CID 95771656
5-[(2R,3aR,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-2-methylisoindole-1,3-dione (PubChem CID 95771656) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-[(2R,3aR,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[(2R,3aR,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 95771656 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 5-[(2R,3aR,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-2-methylisoindole-1,3-dione |
| SMILES | C[C@@H]1C[C@H]2CCCC[C@@H]2N1C(=O)c1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C19H22N2O3/c1-11-9-12-5-3-4-6-16(12)21(11)17(22)13-7-8-14-15(10-13)19(24)20(2)18(14)23/h7-8,10-12,16H,3-6,9H2,1-2H3/t11-,12-,16+/m1/s1 |
| InChIKey | QGGQZLZUZAVOLI-HSMVNMDESA-N |
| XLogP | 2.71 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|