C16H16N2O5 — CID 45427138
1-(2-methyl-1,3-dioxoisoindole-5-carbonyl)piperidine-4-carboxylic acid (PubChem CID 45427138) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is 1-(2-methyl-1,3-dioxoisoindole-5-carbonyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(2-methyl-1,3-dioxoisoindole-5-carbonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 45427138 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-(2-methyl-1,3-dioxoisoindole-5-carbonyl)piperidine-4-carboxylic acid |
| SMILES | CN1C(=O)c2ccc(C(=O)N3CCC(C(=O)O)CC3)cc2C1=O |
| InChI | InChI=1S/C16H16N2O5/c1-17-14(20)11-3-2-10(8-12(11)15(17)21)13(19)18-6-4-9(5-7-18)16(22)23/h2-3,8-9H,4-7H2,1H3,(H,22,23) |
| InChIKey | UFFZZOLUNRQFNF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|