C16H20ClN3O3 — CID 119467995
5-[2-(aminomethyl)piperidine-1-carbonyl]-2-methylisoindole-1,3-dione;hydrochloride (PubChem CID 119467995) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 5-[2-(aminomethyl)piperidine-1-carbonyl]-2-methylisoindole-1,3-dione;hydrochloride.
| Compound Name | 5-[2-(aminomethyl)piperidine-1-carbonyl]-2-methylisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119467995 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 5-[2-(aminomethyl)piperidine-1-carbonyl]-2-methylisoindole-1,3-dione;hydrochloride |
| SMILES | CN1C(=O)c2ccc(C(=O)N3CCCCC3CN)cc2C1=O.Cl |
| InChI | InChI=1S/C16H19N3O3.ClH/c1-18-15(21)12-6-5-10(8-13(12)16(18)22)14(20)19-7-3-2-4-11(19)9-17;/h5-6,8,11H,2-4,7,9,17H2,1H3;1H |
| InChIKey | YBURAUNLQGAWGV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|