C21H22N4O3 — CID 119468549
5-[2-(aminomethyl)piperidine-1-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione (PubChem CID 119468549) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 5-[2-(aminomethyl)piperidine-1-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione.
| Compound Name | 5-[2-(aminomethyl)piperidine-1-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 119468549 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 5-[2-(aminomethyl)piperidine-1-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione |
| SMILES | NCC1CCCCN1C(=O)c1ccc2c(c1)C(=O)N(Cc1ccncc1)C2=O |
| InChI | InChI=1S/C21H22N4O3/c22-12-16-3-1-2-10-24(16)19(26)15-4-5-17-18(11-15)21(28)25(20(17)27)13-14-6-8-23-9-7-14/h4-9,11,16H,1-3,10,12-13,22H2 |
| InChIKey | CEXWGXXSERVIRH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|